Products 1272740-44-9
CAS 1272740-44-9 is the registry number for (S)-1-(3-Chloro-5-methoxyphenyl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3-chloro-5-methoxyphenyl)-2,2,2-trifluoroethanamine (CAS 1272740-44-9) is a chemical compound with the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. IUPAC name: (1S)-1-(3-chloro-5-methoxyphenyl)-2,2,2-trifluoroethanamine. InChIKey: LTSXDUWQMHHBCE-QMMMGPOBSA-N.
| Molecular formula | C9H9ClF3NO |
|---|---|
| Molecular weight | 239.62 g/mol |
| IUPAC name | (1S)-1-(3-chloro-5-methoxyphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | LTSXDUWQMHHBCE-QMMMGPOBSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H](C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)