CAS 127285-54-5 appears in our catalog under these names: 6,7-Dimethoxyquinolin-4(1H)-one 98%, 6,7-Dimethoxyquinolin-4(1H)-one, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 15g, 50g, 75g, 10g.
6,7-dimethoxy-1H-quinolin-4-one (CAS 127285-54-5) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 6,7-dimethoxy-1H-quinolin-4-one. InChIKey: QOGPNCUTXVZQSL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 6,7-dimethoxy-1H-quinolin-4-one |
| InChIKey | QOGPNCUTXVZQSL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C=CN2)OC |
Computed by PubChem (NCBI)