Products 127286-04-8

CAS 127286-04-8 is the registry number for 4-Oxo-1,4-dihydro-quinoline-6-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-oxo-1H-quinoline-6-carboxylate (CAS 127286-04-8) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 4-oxo-1H-quinoline-6-carboxylate. InChIKey: HJEXAEIHROLMFS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO3
Molecular weight217.22 g/mol
IUPAC nameethyl 4-oxo-1H-quinoline-6-carboxylate
InChIKeyHJEXAEIHROLMFS-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=C1)NC=CC2=O

Computed by PubChem (NCBI)