CAS 148018-33-1 appears in our catalog under these names: 4-Hydroxy-quinoline-6-carboxylic acid ethyl ester, 95%, Ethyl 4–hydroxyquinoline–6–carboxylate, 4-Hydroxy-quinoline-6-carboxylic acid ethyl ester, 97%, 97%, ETHYL 4-HYDROXYQUINOLINE-6-CARBOXYLATE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
Ethyl 4-oxo-1H-quinoline-6-carboxylate (CAS 148018-33-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 4-oxo-1H-quinoline-6-carboxylate. InChIKey: HJEXAEIHROLMFS-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | ethyl 4-oxo-1H-quinoline-6-carboxylate |
| InChIKey | HJEXAEIHROLMFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC=CC2=O |
Computed by PubChem (NCBI)