Products 1273524-44-9
CAS 1273524-44-9 is the registry number for FtsZ-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]adamantane-1-carboxamide (CAS 1273524-44-9) is a chemical compound with the molecular formula C26H27NO4 and a molecular weight of 417.5 g/mol. IUPAC name: N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]adamantane-1-carboxamide. InChIKey: IAEGEBQBPTWKEV-LREOWRDNSA-N.
| Molecular formula | C26H27NO4 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]adamantane-1-carboxamide |
| InChIKey | IAEGEBQBPTWKEV-LREOWRDNSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC=C(C=C4)C(=O)/C=C/C5=CC(=C(C=C5)O)O |
Computed by PubChem (NCBI)
Synonyms:
FtsZ-IN-9, orb2566210