CAS 875211-10-2 appears in our catalog under these names: Fmoc-3-Amino-adamantane-1-carboxylic acid, 3-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)adamantane-1-carboxylic acid, ≥95%, ≥95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 250mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)adamantane-1-carboxylic acid (CAS 875211-10-2) is a chemical compound with the molecular formula C26H27NO4 and a molecular weight of 417.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)adamantane-1-carboxylic acid. InChIKey: RXRDRSUDCSEVRK-UHFFFAOYSA-N.
| Molecular formula | C26H27NO4 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)adamantane-1-carboxylic acid |
| InChIKey | RXRDRSUDCSEVRK-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46)C(=O)O |
Computed by PubChem (NCBI)