Products 2217671-41-3
CAS 2217671-41-3 appears in our catalog under these names: POLA1 inhibitor 1, POLA1 inhibitor 1, 98%, 98%, POLA1 inhibitor 1, 98.00%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 100 mg, 25 mg, 5 mg, 10 mg, 10mM/1mL.
(E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-[(E)-hydroxyiminomethyl]phenyl]prop-2-enoic acid (CAS 2217671-41-3) is a chemical compound with the molecular formula C26H27NO4 and a molecular weight of 417.5 g/mol. IUPAC name: (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-[(E)-hydroxyiminomethyl]phenyl]prop-2-enoic acid. InChIKey: PLQNJDDLZLIMNK-DTHWQZMASA-N.
| Molecular formula | C26H27NO4 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-[(E)-hydroxyiminomethyl]phenyl]prop-2-enoic acid |
| InChIKey | PLQNJDDLZLIMNK-DTHWQZMASA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=C(C=C(C=C5)/C=C/C(=O)O)/C=N/O)O |
Computed by PubChem (NCBI)
Synonyms:
orb1687863