CAS 127356-38-1 appears in our catalog under these names: 2-Methoxy-5-nitropyridin-4-amine 95%, 2-Methoxy-5-nitropyridin-4-amine, 97%, 97%, 2-Methoxy-5-nitropyridin-4-amine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2.5g.
2-methoxy-5-nitropyridin-4-amine (CAS 127356-38-1) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 2-methoxy-5-nitropyridin-4-amine. InChIKey: YVXWVLIBEUMASB-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 2-methoxy-5-nitropyridin-4-amine |
| InChIKey | YVXWVLIBEUMASB-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)