CAS 1273677-41-0 is the registry number for 7-Hydroxy-8-iodochroman-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-hydroxy-8-iodo-2,3-dihydrochromen-4-one (CAS 1273677-41-0) is a chemical compound with the molecular formula C9H7IO3 and a molecular weight of 290.05 g/mol. IUPAC name: 7-hydroxy-8-iodo-2,3-dihydrochromen-4-one. InChIKey: GJIAUYWRHKPYLO-UHFFFAOYSA-N.
| Molecular formula | C9H7IO3 |
|---|---|
| Molecular weight | 290.05 g/mol |
| IUPAC name | 7-hydroxy-8-iodo-2,3-dihydrochromen-4-one |
| InChIKey | GJIAUYWRHKPYLO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2I)O |
Computed by PubChem (NCBI)