CAS 847949-05-7 appears in our catalog under these names: 5-Iodo-2,3-dihydro-1-benzofuran-2-carboxylic acid, 95%, 5-Iodo-2,3-dihydrobenzofuran-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-iodo-2,3-dihydro-1-benzofuran-2-carboxylic acid (CAS 847949-05-7) is a chemical compound with the molecular formula C9H7IO3 and a molecular weight of 290.05 g/mol. IUPAC name: 5-iodo-2,3-dihydro-1-benzofuran-2-carboxylic acid. InChIKey: QCXJHQPDRKWMEZ-UHFFFAOYSA-N.
| Molecular formula | C9H7IO3 |
|---|---|
| Molecular weight | 290.05 g/mol |
| IUPAC name | 5-iodo-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| InChIKey | QCXJHQPDRKWMEZ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=C(C=C2)I)C(=O)O |
Computed by PubChem (NCBI)