CAS 177735-27-2 appears in our catalog under these names: Methyl 3-formyl-5-iodobenzoate 98%, Methyl 3-formyl-5-iodobenzoate, 98%, 98%, Methyl 3-formyl-5-iodobenzoate, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-formyl-5-iodobenzoate (CAS 177735-27-2) is a chemical compound with the molecular formula C9H7IO3 and a molecular weight of 290.05 g/mol. IUPAC name: methyl 3-formyl-5-iodobenzoate. InChIKey: YVBDGOASBJTDCU-UHFFFAOYSA-N.
| Molecular formula | C9H7IO3 |
|---|---|
| Molecular weight | 290.05 g/mol |
| IUPAC name | methyl 3-formyl-5-iodobenzoate |
| InChIKey | YVBDGOASBJTDCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C=O)I |
Computed by PubChem (NCBI)