CAS 127378-17-0 is the registry number for (5E)-5-(2,5-Dimethoxybenzylidene)-2-mercapto-1,3-thiazol-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-[(2,5-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 127378-17-0) is a chemical compound with the molecular formula C12H11NO3S2 and a molecular weight of 281.4 g/mol. IUPAC name: 5-[(2,5-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: WEDXIWUKUHJGIR-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 5-[(2,5-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | WEDXIWUKUHJGIR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C=C2C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)