CAS 948016-52-2 is the registry number for 5-(3,4-Dimethoxybenzylidene)-2-thioxo-1,3-thiazolidin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 948016-52-2) is a chemical compound with the molecular formula C12H11NO3S2 and a molecular weight of 281.4 g/mol. IUPAC name: (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: XVAIHVYMCLRIOV-POHAHGRESA-N.
| Molecular formula | C12H11NO3S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | XVAIHVYMCLRIOV-POHAHGRESA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\2/C(=O)NC(=S)S2)OC |
Computed by PubChem (NCBI)