Products 1613505-83-1
CAS 1613505-83-1 is the registry number for N-(2-Formylthiophen-3-yl)-4-methylbenzenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N-(2-formylthiophen-3-yl)-4-methylbenzenesulfonamide (CAS 1613505-83-1) is a chemical compound with the molecular formula C12H11NO3S2 and a molecular weight of 281.4 g/mol. IUPAC name: N-(2-formylthiophen-3-yl)-4-methylbenzenesulfonamide. InChIKey: KMOQRSJCGNXUMC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | N-(2-formylthiophen-3-yl)-4-methylbenzenesulfonamide |
| InChIKey | KMOQRSJCGNXUMC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C=O |
Computed by PubChem (NCBI)