CAS 1273824-82-0 is the registry number for Benzenamine, 2-((3-(3-pyridinyl)-1,2,4-oxadiazol-5-yl)methyl)-, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]aniline (CAS 1273824-82-0) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]aniline. InChIKey: UBXCMOHOTJWEFW-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]aniline |
| InChIKey | UBXCMOHOTJWEFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC(=NO2)C3=CN=CC=C3)N |
Computed by PubChem (NCBI)