CAS 2763750-28-1 is the registry number for 4'-(Azidomethyl)-(1,1'-biphenyl)-2-carboxamide. Offered by: TRC. Available pack sizes: 100mg.
2-[4-(azidomethyl)phenyl]benzamide (CAS 2763750-28-1) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 2-[4-(azidomethyl)phenyl]benzamide. InChIKey: CITOWHKJBDXBBF-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[4-(azidomethyl)phenyl]benzamide |
| InChIKey | CITOWHKJBDXBBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN=[N+]=[N-])C(=O)N |
Computed by PubChem (NCBI)