CAS 127461-51-2 is the registry number for 2,3-Dihydrobenzo[b][1,4]dioxine-6-sulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydro-1,4-benzodioxine-6-sulfonic acid (CAS 127461-51-2) is a chemical compound with the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-sulfonic acid. InChIKey: SPTCVOIKIVNTJJ-UHFFFAOYSA-N.
| Molecular formula | C8H8O5S |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-sulfonic acid |
| InChIKey | SPTCVOIKIVNTJJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)