Products 127461-51-2

CAS 127461-51-2 is the registry number for 2,3-Dihydrobenzo[b][1,4]dioxine-6-sulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3-dihydro-1,4-benzodioxine-6-sulfonic acid (CAS 127461-51-2) is a chemical compound with the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-sulfonic acid. InChIKey: SPTCVOIKIVNTJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O5S
Molecular weight216.21 g/mol
IUPAC name2,3-dihydro-1,4-benzodioxine-6-sulfonic acid
InChIKeySPTCVOIKIVNTJJ-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)S(=O)(=O)O

Computed by PubChem (NCBI)