Products 57897-77-5

CAS 57897-77-5 is the registry number for 2-(methoxycarbonyl)benzenesulfonic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-methoxycarbonylbenzenesulfonic acid (CAS 57897-77-5) is a chemical compound with the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. IUPAC name: 2-methoxycarbonylbenzenesulfonic acid. InChIKey: FLCUEXJOTNUYJB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O5S
Molecular weight216.21 g/mol
IUPAC name2-methoxycarbonylbenzenesulfonic acid
InChIKeyFLCUEXJOTNUYJB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC=C1S(=O)(=O)O

Computed by PubChem (NCBI)