CAS 68029-77-6 is the registry number for 2-Hydroxy-5-methanesulfonylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-hydroxy-5-methylsulfonylbenzoic acid (CAS 68029-77-6) is a chemical compound with the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. IUPAC name: 2-hydroxy-5-methylsulfonylbenzoic acid. InChIKey: QOSVPLTVKMHNQV-UHFFFAOYSA-N.
| Molecular formula | C8H8O5S |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-hydroxy-5-methylsulfonylbenzoic acid |
| InChIKey | QOSVPLTVKMHNQV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)