CAS 1274892-59-9 is the registry number for 3-(2-((4-methylphenyl)sulfonyl)hydrazino)inden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
4-methyl-N'-(3-oxoinden-1-yl)benzenesulfonohydrazide (CAS 1274892-59-9) is a chemical compound with the molecular formula C16H14N2O3S and a molecular weight of 314.4 g/mol. IUPAC name: 4-methyl-N'-(3-oxoinden-1-yl)benzenesulfonohydrazide. InChIKey: PFNYLOPLERMGED-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3S |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-methyl-N'-(3-oxoinden-1-yl)benzenesulfonohydrazide |
| InChIKey | PFNYLOPLERMGED-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NNC2=CC(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)