Products 1275585-93-7

CAS 1275585-93-7 is the registry number for 2-Amino-3-cyanobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-3-cyanobenzoic acid (CAS 1275585-93-7) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-amino-3-cyanobenzoic acid. InChIKey: RWVGEJMJPBHSKR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O2
Molecular weight162.15 g/mol
IUPAC name2-amino-3-cyanobenzoic acid
InChIKeyRWVGEJMJPBHSKR-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)C(=O)O)N)C#N

Computed by PubChem (NCBI)