CAS 1275612-13-9 appears in our catalog under these names: H-Beta-hoglu(otbu)-oh, 95%, H-β-HoGlu(OtBu)-OH, 97%, 97%, H-BETA-HOGLU(OTBU)-OH, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3S)-3-amino-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid (CAS 1275612-13-9) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (3S)-3-amino-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid. InChIKey: KTBUSUJXAJYYFG-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (3S)-3-amino-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
| InChIKey | KTBUSUJXAJYYFG-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)