CAS 127582-76-7 appears in our catalog under these names: Fmoc–7–aminoheptanoic acid, Fmoc-7-Ahp-OH 98%, Fmoc-7-Ahp-OH, 98%, 98%, Fmoc-7-amino-heptanoic acid, 98.88%, 7-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)heptanoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 5 g, 10 g.
7-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid (CAS 127582-76-7) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 7-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid. InChIKey: FRPYXTFBPCYALT-UHFFFAOYSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 7-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid |
| InChIKey | FRPYXTFBPCYALT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCCC(=O)O |
Computed by PubChem (NCBI)