CAS 1276056-90-6 appears in our catalog under these names: 17beta-Dihydroequilenin-4,16,16-d3, 96 atom % D, min 98% Chemical Purity, 17β-Dihydroequilenin-4,16,16-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,005g, 1mg, 5mg.
(17S)-4,16,16-trideuterio-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthrene-3,17-diol (CAS 1276056-90-6) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 271.4 g/mol. IUPAC name: (17S)-4,16,16-trideuterio-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthrene-3,17-diol. InChIKey: RYWZPRVUQHMJFF-XBLPQWITSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 271.4 g/mol |
| IUPAC name | (17S)-4,16,16-trideuterio-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | RYWZPRVUQHMJFF-XBLPQWITSA-N |
| SMILES | [2H]C1=C(C=CC2=C1C=CC3=C2CCC4(C3CC([C@@H]4O)([2H])[2H])C)O |
Computed by PubChem (NCBI)