Products 1276197-36-4
CAS 1276197-36-4 appears in our catalog under these names: (Rac)–Atropine–d3, (Rac)-Atropine-d3, 99.07%, D3-Atropine, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg, 1 mg, 1x1ml.
[8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (CAS 1276197-36-4) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 292.39 g/mol. IUPAC name: [8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate. InChIKey: RKUNBYITZUJHSG-FIBGUPNXSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 292.39 g/mol |
| IUPAC name | [8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| InChIKey | RKUNBYITZUJHSG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
(Rac)-Atropine-d3, orb2300053