Products 13269-35-7
CAS 13269-35-7 appears in our catalog under these names: Atropine Impurity 27, D-Atropine, D-Hyoscyamine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 25mg, 10mg, 100mg.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate (CAS 13269-35-7) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate. InChIKey: RKUNBYITZUJHSG-QXULXFAOSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate |
| InChIKey | RKUNBYITZUJHSG-QXULXFAOSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@@H](CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)