Products 60365-55-1
CAS 60365-55-1 appears in our catalog under these names: (±)-Atropine-D3, >95% (HPLC), Atropine D3 (N-methyl D3), (±)-Atropine-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity. Offered by: TRC, Dr. Ehrenstorfer, CDN. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 0,05g, 0,01g.
[(1S,5R)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (CAS 60365-55-1) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 292.39 g/mol. IUPAC name: [(1S,5R)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate. InChIKey: RKUNBYITZUJHSG-KVOIBRKRSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 292.39 g/mol |
| IUPAC name | [(1S,5R)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| InChIKey | RKUNBYITZUJHSG-KVOIBRKRSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)