CAS 1276197-51-3 appears in our catalog under these names: L-2-Aminobutyric Acid-d6, >95% (HPLC), L-2-Aminobutyric-2,3,3,4,4,4-d6 Acid, 98 atom % D, min 98% Chemical Purity, L–2–Aminobutyric Acid–d6, L-2-Aminobutyric acid-d6, 99.92%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 0,1g, 0,05g, 50mg, 1 mg, 5 mg.
(2S)-2-amino-2,3,3,4,4,4-hexadeuteriobutanoic acid (CAS 1276197-51-3) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 109.16 g/mol. IUPAC name: (2S)-2-amino-2,3,3,4,4,4-hexadeuteriobutanoic acid. InChIKey: QWCKQJZIFLGMSD-MADGHGEDSA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 109.16 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3,4,4,4-hexadeuteriobutanoic acid |
| InChIKey | QWCKQJZIFLGMSD-MADGHGEDSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])[2H])N |
Computed by PubChem (NCBI)