CAS 929202-07-3 appears in our catalog under these names: L-Aminobutyric Acid-d3, >95% (HPLC), L-2-Aminobutyric acid-d3, 99.9%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
(2S)-2-amino-4,4,4-trideuteriobutanoic acid (CAS 929202-07-3) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 106.14 g/mol. IUPAC name: (2S)-2-amino-4,4,4-trideuteriobutanoic acid. InChIKey: QWCKQJZIFLGMSD-SRQSVDBESA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 106.14 g/mol |
| IUPAC name | (2S)-2-amino-4,4,4-trideuteriobutanoic acid |
| InChIKey | QWCKQJZIFLGMSD-SRQSVDBESA-N |
| SMILES | [2H]C([2H])([2H])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)