Products 81339-59-5
CAS 81339-59-5 is the registry number for L-Aminobutyric-2,3,3-d3 Acid. Offered by: TRC. Available pack sizes: 50mg.
2-amino-2,3,3-trideuteriobutanoic acid (CAS 81339-59-5) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 106.14 g/mol. IUPAC name: 2-amino-2,3,3-trideuteriobutanoic acid. InChIKey: QWCKQJZIFLGMSD-UHVFUKFASA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 106.14 g/mol |
| IUPAC name | 2-amino-2,3,3-trideuteriobutanoic acid |
| InChIKey | QWCKQJZIFLGMSD-UHVFUKFASA-N |
| SMILES | [2H]C([2H])(C)C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)