CAS 127720-99-4 is the registry number for Ethyl 5-amino-6-oxo-1-phenyl-1,6-dihydro-1,2,4-triazine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Ethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate (CAS 127720-99-4) is a chemical compound with the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. IUPAC name: ethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate. InChIKey: ONJVQULAOHSFPB-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O3 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | ethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate |
| InChIKey | ONJVQULAOHSFPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=O)C(=N1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)