Products 127720-99-4

CAS 127720-99-4 is the registry number for Ethyl 5-amino-6-oxo-1-phenyl-1,6-dihydro-1,2,4-triazine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate (CAS 127720-99-4) is a chemical compound with the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. IUPAC name: ethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate. InChIKey: ONJVQULAOHSFPB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N4O3
Molecular weight260.25 g/mol
IUPAC nameethyl 5-amino-6-oxo-1-phenyl-1,2,4-triazine-3-carboxylate
InChIKeyONJVQULAOHSFPB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN(C(=O)C(=N1)N)C2=CC=CC=C2

Computed by PubChem (NCBI)