Products 149981-47-5

CAS 149981-47-5 is the registry number for Furafylline-d3. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione (CAS 149981-47-5) is a chemical compound with the molecular formula C12H12N4O3 and a molecular weight of 263.27 g/mol. IUPAC name: 3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione. InChIKey: KGQZGCIVHYLPBH-FIBGUPNXSA-N.

Identity
Molecular formulaC12H12N4O3
Molecular weight263.27 g/mol
IUPAC name3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione
InChIKeyKGQZGCIVHYLPBH-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C1=NC2=C(N1)C(=O)N(C(=O)N2CC3=CC=CO3)C

Computed by PubChem (NCBI)