CAS 149981-47-5 is the registry number for Furafylline-d3. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione (CAS 149981-47-5) is a chemical compound with the molecular formula C12H12N4O3 and a molecular weight of 263.27 g/mol. IUPAC name: 3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione. InChIKey: KGQZGCIVHYLPBH-FIBGUPNXSA-N.
| Molecular formula | C12H12N4O3 |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 3-(furan-2-ylmethyl)-1-methyl-8-(trideuteriomethyl)-7H-purine-2,6-dione |
| InChIKey | KGQZGCIVHYLPBH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC2=C(N1)C(=O)N(C(=O)N2CC3=CC=CO3)C |
Computed by PubChem (NCBI)