CAS 160948-33-4 appears in our catalog under these names: 4–(benzyloxy)–6–methyl–5–nitropyrimidin–2–amine, 4-(Benzyloxy)-6-methyl-5-nitropyrimidin-2-amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
4-methyl-5-nitro-6-phenylmethoxypyrimidin-2-amine (CAS 160948-33-4) is a chemical compound with the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. IUPAC name: 4-methyl-5-nitro-6-phenylmethoxypyrimidin-2-amine. InChIKey: QRPFYXCKZRCRTD-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O3 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | 4-methyl-5-nitro-6-phenylmethoxypyrimidin-2-amine |
| InChIKey | QRPFYXCKZRCRTD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)N)OCC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)