Products 127731-60-6
CAS 127731-60-6 is the registry number for 5-Chloro-1,4-dihydro-2,3-quinoxalinedione. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-1,4-dihydroquinoxaline-2,3-dione (CAS 127731-60-6) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloro-1,4-dihydroquinoxaline-2,3-dione. InChIKey: ZQIVPRINVRSPLR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-chloro-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | ZQIVPRINVRSPLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)