CAS 127753-94-0 is the registry number for Ethyl 1-thio-α-L-rhamnopyranoside. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.
(2S,3R,4R,5R,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol (CAS 127753-94-0) is a chemical compound with the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. IUPAC name: (2S,3R,4R,5R,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol. InChIKey: FFRRGRSSCFQGAP-TXXZRHAASA-N.
| Molecular formula | C8H16O4S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | (2S,3R,4R,5R,6S)-2-ethylsulfanyl-6-methyloxane-3,4,5-triol |
| InChIKey | FFRRGRSSCFQGAP-TXXZRHAASA-N |
| SMILES | CCS[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O |
Computed by PubChem (NCBI)