Products 127762-22-5
CAS 127762-22-5 is the registry number for (E)-3-(BENZYLOXY)ACRYLIC ACID, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(E)-3-phenylmethoxyprop-2-enoic acid (CAS 127762-22-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (E)-3-phenylmethoxyprop-2-enoic acid. InChIKey: OATHOHOHNMLMEQ-VOTSOKGWSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (E)-3-phenylmethoxyprop-2-enoic acid |
| InChIKey | OATHOHOHNMLMEQ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)CO/C=C/C(=O)O |
Computed by PubChem (NCBI)