CAS 127813-37-0 appears in our catalog under these names: 2-(2-Bromophenyl)ethanimidamide hydrochloride, 95%, 2-(2-Bromophenyl)acetimidamide hydrochloride, 97%, 2-(2-Bromophenyl)ethanimidamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 50mg, 0,5g.
2-(2-bromophenyl)ethanimidamide;hydrochloride (CAS 127813-37-0) is a chemical compound with the molecular formula C8H10BrClN2 and a molecular weight of 249.53 g/mol. IUPAC name: 2-(2-bromophenyl)ethanimidamide;hydrochloride. InChIKey: GTVFCTLUZMPIJI-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2 |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 2-(2-bromophenyl)ethanimidamide;hydrochloride |
| InChIKey | GTVFCTLUZMPIJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=N)N)Br.Cl |
Computed by PubChem (NCBI)