CAS 6487-97-4 appears in our catalog under these names: 2-(4-Bromophenyl)ethanimidamide hydrochloride, 95%, 2-(4-Bromo-phenyl)-acetamidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-bromophenyl)ethanimidamide;hydrochloride (CAS 6487-97-4) is a chemical compound with the molecular formula C8H10BrClN2 and a molecular weight of 249.53 g/mol. IUPAC name: 2-(4-bromophenyl)ethanimidamide;hydrochloride. InChIKey: WJPKYOOURIMUTE-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2 |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 2-(4-bromophenyl)ethanimidamide;hydrochloride |
| InChIKey | WJPKYOOURIMUTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=N)N)Br.Cl |
Computed by PubChem (NCBI)