CAS 1506786-09-9 is the registry number for 5-Bromo-2-(butan-2-yl)-4-chloropyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-2-butan-2-yl-4-chloropyrimidine (CAS 1506786-09-9) is a chemical compound with the molecular formula C8H10BrClN2 and a molecular weight of 249.53 g/mol. IUPAC name: 5-bromo-2-butan-2-yl-4-chloropyrimidine. InChIKey: PSIAZRNNZHABSQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2 |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 5-bromo-2-butan-2-yl-4-chloropyrimidine |
| InChIKey | PSIAZRNNZHABSQ-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=NC=C(C(=N1)Cl)Br |
Computed by PubChem (NCBI)