CAS 1278579-62-6 is the registry number for 5–(Piperidino)thiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]piperidine (CAS 1278579-62-6) is a chemical compound with the molecular formula C15H24BNO2S and a molecular weight of 293.2 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]piperidine. InChIKey: FHMILFMVQMSIIR-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2S |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]piperidine |
| InChIKey | FHMILFMVQMSIIR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)N3CCCCC3 |
Computed by PubChem (NCBI)