CAS 1402166-61-3 is the registry number for 2-(Cyclohexyl)thiazole-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
2-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1402166-61-3) is a chemical compound with the molecular formula C15H24BNO2S and a molecular weight of 293.2 g/mol. IUPAC name: 2-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: UAJPOSXPKUPXAP-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2S |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 2-cyclohexyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | UAJPOSXPKUPXAP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)C3CCCCC3 |
Computed by PubChem (NCBI)