CAS 1593701-55-3 is the registry number for 2-(Butylthio)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1593701-55-3) is a chemical compound with the molecular formula C15H24BNO2S and a molecular weight of 293.2 g/mol. IUPAC name: 2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VVZVALRNHHRYGB-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2S |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VVZVALRNHHRYGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)SCCCC |
Computed by PubChem (NCBI)