CAS 127862-89-9 appears in our catalog under these names: Z–Homophe–OH, Z-Homophe-OH, 98%, 98%, (S)-2-(((Benzyloxy)carbonyl)amino)-4-phenylbutanoic acid, 98%, Cbz-HoPhe-OH, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
(2S)-4-phenyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 127862-89-9) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (2S)-4-phenyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: GUWSQYJXSRIJCI-INIZCTEOSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (2S)-4-phenyl-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | GUWSQYJXSRIJCI-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)