CAS 127866-81-3 is the registry number for 1-(2,6-Dimethylphenyl)-1H-1,2,3,4-tetrazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,6-dimethylphenyl)tetrazol-5-amine (CAS 127866-81-3) is a chemical compound with the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. IUPAC name: 1-(2,6-dimethylphenyl)tetrazol-5-amine. InChIKey: GUKRUMMXLOLWCY-UHFFFAOYSA-N.
| Molecular formula | C9H11N5 |
|---|---|
| Molecular weight | 189.22 g/mol |
| IUPAC name | 1-(2,6-dimethylphenyl)tetrazol-5-amine |
| InChIKey | GUKRUMMXLOLWCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C(=NN=N2)N |
Computed by PubChem (NCBI)