Products 127919-31-7
CAS 127919-31-7 is the registry number for Ethyl 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylate (CAS 127919-31-7) is a chemical compound with the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. IUPAC name: ethyl 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylate. InChIKey: PFTXDVDQXHOLAW-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | ethyl 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylate |
| InChIKey | PFTXDVDQXHOLAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC=N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)
Synonyms:
ethyl 5-(4-fluorophenyl)-1,3-oxazole-4-carboxylate, 5-(4-Fluorophenyl)oxazole-4-carboxylic acid ethyl ester, Ethyl 5-(4-fluorophenyl)-4-oxazolecarboxylate, 4-Oxazolecarboxylic acid, 5-(4-fluorophenyl)-, ethyl ester, 5-(4-Fluoro-phenyl)-oxazole-4-carboxylic acid ethyl ester, 5-(4-Fluorophenyl)-oxazole-4-carboxylic acid ethyl ester, 5-(4-Fluoro-phenyl)-oxazole-4-carboxylic acid ethyl ester, 95%