Products 1279698-22-4
CAS 1279698-22-4 appears in our catalog under these names: Methyl 5-(aminomethyl)pyrazine-2-carboxylate hydrochloride, 95%, Methyl 5-(aminomethyl)pyrazine-2-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 5-(aminomethyl)pyrazine-2-carboxylate;hydrochloride (CAS 1279698-22-4) is a chemical compound with the molecular formula C7H10ClN3O2 and a molecular weight of 203.62 g/mol. IUPAC name: methyl 5-(aminomethyl)pyrazine-2-carboxylate;hydrochloride. InChIKey: LNLANIJRJDKDJZ-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O2 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | methyl 5-(aminomethyl)pyrazine-2-carboxylate;hydrochloride |
| InChIKey | LNLANIJRJDKDJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(N=C1)CN.Cl |
Computed by PubChem (NCBI)