CAS 1598419-97-6 is the registry number for Methyl 2-amino-2-(pyrazin-2-yl)acetate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-2-pyrazin-2-ylacetate;hydrochloride (CAS 1598419-97-6) is a chemical compound with the molecular formula C7H10ClN3O2 and a molecular weight of 203.62 g/mol. IUPAC name: methyl 2-amino-2-pyrazin-2-ylacetate;hydrochloride. InChIKey: NMNOTPYBKZVHFL-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O2 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | methyl 2-amino-2-pyrazin-2-ylacetate;hydrochloride |
| InChIKey | NMNOTPYBKZVHFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=NC=CN=C1)N.Cl |
Computed by PubChem (NCBI)