Products 2108415-77-4
CAS 2108415-77-4 appears in our catalog under these names: (S)-2-Amino-3-(pyridazin-3-yl)propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(pyridazin–3–yl)propanoic acid hydrochloride, H-Ala(pyridazin-3-yl)-OH HCl 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 25mg, 50mg.
(2S)-2-amino-3-pyridazin-3-ylpropanoic acid;hydrochloride (CAS 2108415-77-4) is a chemical compound with the molecular formula C7H10ClN3O2 and a molecular weight of 203.62 g/mol. IUPAC name: (2S)-2-amino-3-pyridazin-3-ylpropanoic acid;hydrochloride. InChIKey: UAAWXMAYFWIDDQ-RGMNGODLSA-N.
| Molecular formula | C7H10ClN3O2 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | (2S)-2-amino-3-pyridazin-3-ylpropanoic acid;hydrochloride |
| InChIKey | UAAWXMAYFWIDDQ-RGMNGODLSA-N |
| SMILES | C1=CC(=NN=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)