CAS 1279865-95-0 appears in our catalog under these names: Methyl 3–amino–1H–indazole–6–carboxylate, Methyl 3-amino-1H-indazole-6-carboxylate. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 0,5g, 50mg.
Methyl 3-amino-1H-indazole-6-carboxylate (CAS 1279865-95-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 3-amino-1H-indazole-6-carboxylate. InChIKey: JBNDPDJGDUNATA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 3-amino-1H-indazole-6-carboxylate |
| InChIKey | JBNDPDJGDUNATA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=NN2)N |
Computed by PubChem (NCBI)