Products 128008-87-7
CAS 128008-87-7 appears in our catalog under these names: 2-Nitrofluorene-d9, >95% (HPLC), 2-Nitrofluorene-d9, 98 atom % D, min 98% Chemical Purity, 2-Nitro-9H-fluorene-d9. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 25 mg, 1 mg, 10 mg.
1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene (CAS 128008-87-7) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 220.27 g/mol. IUPAC name: 1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene. InChIKey: XFOHWECQTFIEIX-MFNUZUOVSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene |
| InChIKey | XFOHWECQTFIEIX-MFNUZUOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H] |
Computed by PubChem (NCBI)